C12H16F6O — CID 134172266
(3E,5E)-1,1,1-trifluoro-7-methoxy-2,6-dimethyl-4-(trifluoromethyl)octa-3,5-diene (PubChem CID 134172266) has the molecular formula C12H16F6O and a molecular weight of 290.25 g/mol. Its IUPAC name is (3E,5E)-1,1,1-trifluoro-7-methoxy-2,6-dimethyl-4-(trifluoromethyl)octa-3,5-diene.
| Compound Name | (3E,5E)-1,1,1-trifluoro-7-methoxy-2,6-dimethyl-4-(trifluoromethyl)octa-3,5-diene |
|---|---|
| PubChem CID | 134172266 |
| Molecular Formula | C12H16F6O |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (3E,5E)-1,1,1-trifluoro-7-methoxy-2,6-dimethyl-4-(trifluoromethyl)octa-3,5-diene |
| SMILES | COC(C)/C(C)=C/C(=C\C(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6O/c1-7(9(3)19-4)5-10(12(16,17)18)6-8(2)11(13,14)15/h5-6,8-9H,1-4H3/b7-5+,10-6+ |
| InChIKey | LPQCTQBRCWCTGV-YLNKAEQOSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|