About propan-2-yliminomethyl methanimidothioate
propan-2-yliminomethyl methanimidothioate (PubChem CID 134172357) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is propan-2-yliminomethyl methanimidothioate.
Molecular Properties
| Compound Name | propan-2-yliminomethyl methanimidothioate |
| PubChem CID | 134172357 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | propan-2-yliminomethyl methanimidothioate |
| SMILES | [H]/N=C/S/C=N/C(C)C |
| InChI | InChI=1S/C5H10N2S/c1-5(2)7-4-8-3-6/h3-6H,1-2H3/b6-3+,7-4+ |
| InChIKey | VSCLNSBIXGORLQ-XOKGJFMYSA-N |
| XLogP | 1.76 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yliminomethyl methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yliminomethyl methanimidothioate?
The IUPAC name of propan-2-yliminomethyl methanimidothioate (CID 134172357) is propan-2-yliminomethyl methanimidothioate.
What is the SMILES notation for propan-2-yliminomethyl methanimidothioate?
The canonical SMILES for propan-2-yliminomethyl methanimidothioate is [H]/N=C/S/C=N/C(C)C.
What is the InChIKey of propan-2-yliminomethyl methanimidothioate?
The InChIKey is VSCLNSBIXGORLQ-XOKGJFMYSA-N. The full InChI is InChI=1S/C5H10N2S/c1-5(2)7-4-8-3-6/h3-6H,1-2H3/b6-3+,7-4+.
What are the key properties of propan-2-yliminomethyl methanimidothioate?
propan-2-yliminomethyl methanimidothioate has a molecular weight of 130.22 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yliminomethyl methanimidothioate is sourced from PubChem (CID 134172357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).