C20H22FN — CID 134172855
(4aZ,6Z)-7-[(5-fluoro-6-methylcyclohexa-2,4-dien-1-yl)methyl]-9,10-didehydro-3,4,8,10a-tetrahydro-2H-benzo[8]annulen-1-imine (PubChem CID 134172855) has the molecular formula C20H22FN and a molecular weight of 295.40 g/mol. Its IUPAC name is (4aZ,6Z)-7-[(5-fluoro-6-methylcyclohexa-2,4-dien-1-yl)methyl]-9,10-didehydro-3,4,8,10a-tetrahydro-2H-benzo[8]annulen-1-imine.
| Compound Name | (4aZ,6Z)-7-[(5-fluoro-6-methylcyclohexa-2,4-dien-1-yl)methyl]-9,10-didehydro-3,4,8,10a-tetrahydro-2H-benzo[8]annulen-1-imine |
|---|---|
| PubChem CID | 134172855 |
| Molecular Formula | C20H22FN |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (4aZ,6Z)-7-[(5-fluoro-6-methylcyclohexa-2,4-dien-1-yl)methyl]-9,10-didehydro-3,4,8,10a-tetrahydro-2H-benzo[8]annulen-1-imine |
| SMILES | [H]/N=C1\CCC/C2=C/C=C(/CC3C=CC=C(F)C3C)CC#CC21 |
| InChI | InChI=1S/C20H22FN/c1-14-17(7-3-9-19(14)21)13-15-5-2-8-18-16(12-11-15)6-4-10-20(18)22/h3,7,9,11-12,14,17-18,22H,4-6,10,13H2,1H3/b15-11+,16-12-,22-20+ |
| InChIKey | ZYDBHKVJOVYQNH-HLUUUYRLSA-N |
| XLogP | 5.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|