About (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid
(Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid (PubChem CID 13417293) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid.
Molecular Properties
| Compound Name | (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid |
| PubChem CID | 13417293 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid |
| SMILES | CC(C)(CCCC/C=C(/c1ccccc1)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C21H25NO2/c1-21(2,20(23)24)14-8-4-7-13-19(17-10-5-3-6-11-17)18-12-9-15-22-16-18/h3,5-6,9-13,15-16H,4,7-8,14H2,1-2H3,(H,23,24)/b19-13- |
| InChIKey | COXWJDIIGQLOLY-UYRXBGFRSA-N |
| XLogP | 5.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid?
The IUPAC name of (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid (CID 13417293) is (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid.
What is the SMILES notation for (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid?
The canonical SMILES for (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid is CC(C)(CCCC/C=C(/c1ccccc1)c1cccnc1)C(=O)O.
What is the InChIKey of (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid?
The InChIKey is COXWJDIIGQLOLY-UYRXBGFRSA-N. The full InChI is InChI=1S/C21H25NO2/c1-21(2,20(23)24)14-8-4-7-13-19(17-10-5-3-6-11-17)18-12-9-15-22-16-18/h3,5-6,9-13,15-16H,4,7-8,14H2,1-2H3,(H,23,24)/b19-13-.
What are the key properties of (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid?
(Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid has a molecular weight of 323.44 g/mol, XLogP of 5.18, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,2-dimethyl-8-phenyl-8-pyridin-3-yloct-7-enoic acid is sourced from PubChem (CID 13417293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).