About 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile
2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 134172951) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 134172951 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | C=C(C)NC1CC(CC)=CC(CC)=C1C#N |
| InChI | InChI=1S/C14H20N2/c1-5-11-7-12(6-2)13(9-15)14(8-11)16-10(3)4/h7,14,16H,3,5-6,8H2,1-2,4H3 |
| InChIKey | IFYDRRAZVDYGBK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile (CID 134172951) is 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile is C=C(C)NC1CC(CC)=CC(CC)=C1C#N.
What is the InChIKey of 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is IFYDRRAZVDYGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-5-11-7-12(6-2)13(9-15)14(8-11)16-10(3)4/h7,14,16H,3,5-6,8H2,1-2,4H3.
What are the key properties of 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile?
2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 216.33 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-6-(prop-1-en-2-ylamino)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 134172951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).