C15H18S — CID 134173049
3-[(1Z)-buta-1,3-dienyl]-2,3a,4-trimethyl-7aH-1-benzothiophene (PubChem CID 134173049) has the molecular formula C15H18S and a molecular weight of 230.38 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2,3a,4-trimethyl-7aH-1-benzothiophene.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2,3a,4-trimethyl-7aH-1-benzothiophene |
|---|---|
| PubChem CID | 134173049 |
| Molecular Formula | C15H18S |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2,3a,4-trimethyl-7aH-1-benzothiophene |
| SMILES | C=C/C=C\C1=C(C)SC2C=CC=C(C)C12C |
| InChI | InChI=1S/C15H18S/c1-5-6-9-13-12(3)16-14-10-7-8-11(2)15(13,14)4/h5-10,14H,1H2,2-4H3/b9-6- |
| InChIKey | JRZYLESPCYPPMN-TWGQIWQCSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|