C13H23F3O3S2 — CID 134173596
5,6-dimethyl-2-[1,1,1-trifluoro-3-(3-sulfanylpropylsulfanyl)propan-2-yl]oxyoxan-3-ol (PubChem CID 134173596) has the molecular formula C13H23F3O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 5,6-dimethyl-2-[1,1,1-trifluoro-3-(3-sulfanylpropylsulfanyl)propan-2-yl]oxyoxan-3-ol.
| Compound Name | 5,6-dimethyl-2-[1,1,1-trifluoro-3-(3-sulfanylpropylsulfanyl)propan-2-yl]oxyoxan-3-ol |
|---|---|
| PubChem CID | 134173596 |
| Molecular Formula | C13H23F3O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5,6-dimethyl-2-[1,1,1-trifluoro-3-(3-sulfanylpropylsulfanyl)propan-2-yl]oxyoxan-3-ol |
| SMILES | CC1CC(O)C(OC(CSCCCS)C(F)(F)F)OC1C |
| InChI | InChI=1S/C13H23F3O3S2/c1-8-6-10(17)12(18-9(8)2)19-11(13(14,15)16)7-21-5-3-4-20/h8-12,17,20H,3-7H2,1-2H3 |
| InChIKey | GVQNRKKZVVAYSQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|