About benzyl N-phenylmethoxycarbamate
benzyl N-phenylmethoxycarbamate (PubChem CID 13417381) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is benzyl N-phenylmethoxycarbamate.
Molecular Properties
| Compound Name | benzyl N-phenylmethoxycarbamate |
| PubChem CID | 13417381 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | benzyl N-phenylmethoxycarbamate |
| SMILES | O=C(NOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H15NO3/c17-15(18-11-13-7-3-1-4-8-13)16-19-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17) |
| InChIKey | PIMQUYFJDPYHBL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-phenylmethoxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-phenylmethoxycarbamate?
The IUPAC name of benzyl N-phenylmethoxycarbamate (CID 13417381) is benzyl N-phenylmethoxycarbamate.
What is the SMILES notation for benzyl N-phenylmethoxycarbamate?
The canonical SMILES for benzyl N-phenylmethoxycarbamate is O=C(NOCc1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl N-phenylmethoxycarbamate?
The InChIKey is PIMQUYFJDPYHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c17-15(18-11-13-7-3-1-4-8-13)16-19-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17).
What are the key properties of benzyl N-phenylmethoxycarbamate?
benzyl N-phenylmethoxycarbamate has a molecular weight of 257.29 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-phenylmethoxycarbamate is sourced from PubChem (CID 13417381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).