C25H39N5O8 — CID 134174313
(2S)-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-6-formamidohexanoic acid (PubChem CID 134174313) has the molecular formula C25H39N5O8 and a molecular weight of 537.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-6-formamidohexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-6-formamidohexanoic acid |
|---|---|
| PubChem CID | 134174313 |
| Molecular Formula | C25H39N5O8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-6-formamidohexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCNC=O)C(=O)O |
| InChI | InChI=1S/C25H39N5O8/c1-16(2)22(29-19(32)10-5-4-8-14-30-20(33)11-12-21(30)34)24(36)27-17(3)23(35)28-18(25(37)38)9-6-7-13-26-15-31/h11-12,15-18,22H,4-10,13-14H2,1-3H3,(H,26,31)(H,27,36)(H,28,35)(H,29,32)(H,37,38)/t17-,18-,22-/m0/s1 |
| InChIKey | NHDGSWVVFBVGEX-SPEDKVCISA-N |
| XLogP | -0.40 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|