About 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole
2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole (PubChem CID 134174444) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole |
| PubChem CID | 134174444 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole |
| SMILES | Cc1nc2ccc3c(c2s1)CCO3 |
| InChI | InChI=1S/C10H9NOS/c1-6-11-8-2-3-9-7(4-5-12-9)10(8)13-6/h2-3H,4-5H2,1H3 |
| InChIKey | ANQXLLWAAAPGNS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole?
The IUPAC name of 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole (CID 134174444) is 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole.
What is the SMILES notation for 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole?
The canonical SMILES for 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole is Cc1nc2ccc3c(c2s1)CCO3.
What is the InChIKey of 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole?
The InChIKey is ANQXLLWAAAPGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c1-6-11-8-2-3-9-7(4-5-12-9)10(8)13-6/h2-3H,4-5H2,1H3.
What are the key properties of 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole?
2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole has a molecular weight of 191.25 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7,8-dihydrofuro[2,3-g][1,3]benzothiazole is sourced from PubChem (CID 134174444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).