About (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one
(2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one (PubChem CID 134174560) has the molecular formula C12H11ClO2
and a molecular weight of 222.67 g/mol. Its IUPAC name is (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one.
Molecular Properties
| Compound Name | (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one |
| PubChem CID | 134174560 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one |
| SMILES | C=C/C=c1/oc(CCl)cc(=O)/c1=C/C=C |
| InChI | InChI=1S/C12H11ClO2/c1-3-5-10-11(14)7-9(8-13)15-12(10)6-4-2/h3-7H,1-2,8H2/b10-5-,12-6+ |
| InChIKey | DHPNIZVYPPLWPO-QKHYZZJUSA-N |
| XLogP | 1.31 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one?
The IUPAC name of (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one (CID 134174560) is (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one.
What is the SMILES notation for (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one?
The canonical SMILES for (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one is C=C/C=c1/oc(CCl)cc(=O)/c1=C/C=C.
What is the InChIKey of (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one?
The InChIKey is DHPNIZVYPPLWPO-QKHYZZJUSA-N. The full InChI is InChI=1S/C12H11ClO2/c1-3-5-10-11(14)7-9(8-13)15-12(10)6-4-2/h3-7H,1-2,8H2/b10-5-,12-6+.
What are the key properties of (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one?
(2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one has a molecular weight of 222.67 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-6-(chloromethyl)-2,3-bis(prop-2-enylidene)pyran-4-one is sourced from PubChem (CID 134174560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).