About 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole
7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole (PubChem CID 134174901) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole.
Molecular Properties
| Compound Name | 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole |
| PubChem CID | 134174901 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole |
| SMILES | Cc1nc2c3c(ccc2[nH]1)OCO3 |
| InChI | InChI=1S/C9H8N2O2/c1-5-10-6-2-3-7-9(8(6)11-5)13-4-12-7/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | GLWYRPRBHMKYDG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole?
The IUPAC name of 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole (CID 134174901) is 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole.
What is the SMILES notation for 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole?
The canonical SMILES for 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole is Cc1nc2c3c(ccc2[nH]1)OCO3.
What is the InChIKey of 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole?
The InChIKey is GLWYRPRBHMKYDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-5-10-6-2-3-7-9(8(6)11-5)13-4-12-7/h2-3H,4H2,1H3,(H,10,11).
What are the key properties of 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole?
7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole has a molecular weight of 176.17 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6H-[1,3]dioxolo[4,5-e]benzimidazole is sourced from PubChem (CID 134174901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).