C22H35N5O7 — CID 134175373
(2S)-6-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hexanoic acid (PubChem CID 134175373) has the molecular formula C22H35N5O7 and a molecular weight of 481.55 g/mol. Its IUPAC name is (2S)-6-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 134175373 |
| Molecular Formula | C22H35N5O7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (2S)-6-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H35N5O7/c1-14(2)19(20(31)25-15(21(32)33)8-5-6-12-24-22(23)34)26-16(28)9-4-3-7-13-27-17(29)10-11-18(27)30/h10-11,14-15,19H,3-9,12-13H2,1-2H3,(H,25,31)(H,26,28)(H,32,33)(H3,23,24,34)/t15-,19-/m0/s1 |
| InChIKey | KWAMBJUFRUJPHK-KXBFYZLASA-N |
| XLogP | 0.02 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|