C16H29NO3 — CID 134175629
(3Z,5E)-4-ethoxy-N-[2-(2-ethoxyethoxy)ethyl]-N-methylhepta-1,3,5-trien-3-amine (PubChem CID 134175629) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (3Z,5E)-4-ethoxy-N-[2-(2-ethoxyethoxy)ethyl]-N-methylhepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5E)-4-ethoxy-N-[2-(2-ethoxyethoxy)ethyl]-N-methylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 134175629 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (3Z,5E)-4-ethoxy-N-[2-(2-ethoxyethoxy)ethyl]-N-methylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C(\C=C\C)OCC)N(C)CCOCCOCC |
| InChI | InChI=1S/C16H29NO3/c1-6-10-16(20-9-4)15(7-2)17(5)11-12-19-14-13-18-8-3/h6-7,10H,2,8-9,11-14H2,1,3-5H3/b10-6+,16-15- |
| InChIKey | IPKQWRDWWVQBPZ-ZQMRGCAXSA-N |
| XLogP | 2.98 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|