C28H34O7 — CID 134176105
(1S,5R,6R,11R,14S,21S,22R)-5,6,22-trihydroxy-11,17,18,21-tetramethyl-15-oxaheptacyclo[12.11.0.01,22.02,25.03,12.06,11.014,19]pentacosa-8,17-diene-10,16,20-trione (PubChem CID 134176105) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is (1S,5R,6R,11R,14S,21S,22R)-5,6,22-trihydroxy-11,17,18,21-tetramethyl-15-oxaheptacyclo[12.11.0.01,22.02,25.03,12.06,11.014,19]pentacosa-8,17-diene-10,16,20-trione.
| Compound Name | (1S,5R,6R,11R,14S,21S,22R)-5,6,22-trihydroxy-11,17,18,21-tetramethyl-15-oxaheptacyclo[12.11.0.01,22.02,25.03,12.06,11.014,19]pentacosa-8,17-diene-10,16,20-trione |
|---|---|
| PubChem CID | 134176105 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | (1S,5R,6R,11R,14S,21S,22R)-5,6,22-trihydroxy-11,17,18,21-tetramethyl-15-oxaheptacyclo[12.11.0.01,22.02,25.03,12.06,11.014,19]pentacosa-8,17-diene-10,16,20-trione |
| SMILES | CC1=C(C)C2C(=O)[C@@H](C)[C@]3(O)CCC4C5C6C[C@@H](O)[C@@]7(O)CC=CC(=O)[C@]7(C)C6C[C@@]2(OC1=O)[C@@]453 |
| InChI | InChI=1S/C28H34O7/c1-12-13(2)23(32)35-27-11-17-15(10-19(30)26(34)8-5-6-18(29)24(17,26)4)21-16-7-9-25(33,28(16,21)27)14(3)22(31)20(12)27/h5-6,14-17,19-21,30,33-34H,7-11H2,1-4H3/t14-,15?,16?,17?,19-,20?,21?,24+,25-,26+,27+,28+/m1/s1 |
| InChIKey | JEJWSDRJYZUEOJ-XKQIGVAJSA-N |
| XLogP | 1.88 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |