C7H13O5P — CID 134176711
[(1S,3S,5R)-5-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl dihydrogen phosphate (PubChem CID 134176711) has the molecular formula C7H13O5P and a molecular weight of 208.15 g/mol. Its IUPAC name is [(1S,3S,5R)-5-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl dihydrogen phosphate.
| Compound Name | [(1S,3S,5R)-5-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 134176711 |
| Molecular Formula | C7H13O5P |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | [(1S,3S,5R)-5-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl dihydrogen phosphate |
| SMILES | C[C@@]12C[C@@H](COP(=O)(O)O)O[C@H]1C2 |
| InChI | InChI=1S/C7H13O5P/c1-7-2-5(12-6(7)3-7)4-11-13(8,9)10/h5-6H,2-4H2,1H3,(H2,8,9,10)/t5-,6-,7-/m0/s1 |
| InChIKey | DCPQHADQIUOYAE-ACZMJKKPSA-N |
| XLogP | 0.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|