About (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine
(5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine (PubChem CID 134177812) has the molecular formula C10H16ClN
and a molecular weight of 185.70 g/mol. Its IUPAC name is (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine |
| PubChem CID | 134177812 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=CC[C@@H](C)[C@@]1(C)CCCl |
| InChI | InChI=1S/C10H16ClN/c1-8-4-3-5-9(12)10(8,2)6-7-11/h3,5,8,12H,4,6-7H2,1-2H3/b12-9+/t8-,10-/m1/s1 |
| InChIKey | CUTQYSLFSSVDFX-ONDIQWEDSA-N |
| XLogP | 3.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine?
The IUPAC name of (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine (CID 134177812) is (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine.
What is the SMILES notation for (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine?
The canonical SMILES for (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine is [H]/N=C1\C=CC[C@@H](C)[C@@]1(C)CCCl.
What is the InChIKey of (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine?
The InChIKey is CUTQYSLFSSVDFX-ONDIQWEDSA-N. The full InChI is InChI=1S/C10H16ClN/c1-8-4-3-5-9(12)10(8,2)6-7-11/h3,5,8,12H,4,6-7H2,1-2H3/b12-9+/t8-,10-/m1/s1.
What are the key properties of (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine?
(5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine has a molecular weight of 185.70 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6R)-6-(2-chloroethyl)-5,6-dimethylcyclohex-2-en-1-imine is sourced from PubChem (CID 134177812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).