About 2-ethyl-4,6-difluoro-3-methylphenol
2-ethyl-4,6-difluoro-3-methylphenol (PubChem CID 134178031) has the molecular formula C9H10F2O
and a molecular weight of 172.17 g/mol. Its IUPAC name is 2-ethyl-4,6-difluoro-3-methylphenol.
Molecular Properties
| Compound Name | 2-ethyl-4,6-difluoro-3-methylphenol |
| PubChem CID | 134178031 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-ethyl-4,6-difluoro-3-methylphenol |
| SMILES | CCc1c(C)c(F)cc(F)c1O |
| InChI | InChI=1S/C9H10F2O/c1-3-6-5(2)7(10)4-8(11)9(6)12/h4,12H,3H2,1-2H3 |
| InChIKey | CVEZIPRZLUWCNB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-4,6-difluoro-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,6-difluoro-3-methylphenol?
The IUPAC name of 2-ethyl-4,6-difluoro-3-methylphenol (CID 134178031) is 2-ethyl-4,6-difluoro-3-methylphenol.
What is the SMILES notation for 2-ethyl-4,6-difluoro-3-methylphenol?
The canonical SMILES for 2-ethyl-4,6-difluoro-3-methylphenol is CCc1c(C)c(F)cc(F)c1O.
What is the InChIKey of 2-ethyl-4,6-difluoro-3-methylphenol?
The InChIKey is CVEZIPRZLUWCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2O/c1-3-6-5(2)7(10)4-8(11)9(6)12/h4,12H,3H2,1-2H3.
What are the key properties of 2-ethyl-4,6-difluoro-3-methylphenol?
2-ethyl-4,6-difluoro-3-methylphenol has a molecular weight of 172.17 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,6-difluoro-3-methylphenol is sourced from PubChem (CID 134178031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).