About 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene
3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene (PubChem CID 13417814) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene.
Molecular Properties
| Compound Name | 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene |
| PubChem CID | 13417814 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene |
| SMILES | C(=CC1=CC=CC1)=Cc1ccccc1 |
| InChI | InChI=1S/C14H12/c1-2-7-13(8-3-1)11-6-12-14-9-4-5-10-14/h1-5,7-9,11-12H,10H2 |
| InChIKey | XQVWOPQKMWFWJW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene?
The IUPAC name of 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene (CID 13417814) is 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene.
What is the SMILES notation for 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene?
The canonical SMILES for 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene is C(=CC1=CC=CC1)=Cc1ccccc1.
What is the InChIKey of 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene?
The InChIKey is XQVWOPQKMWFWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12/c1-2-7-13(8-3-1)11-6-12-14-9-4-5-10-14/h1-5,7-9,11-12H,10H2.
What are the key properties of 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene?
3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene has a molecular weight of 180.25 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienylbenzene is sourced from PubChem (CID 13417814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).