C16H11ClN4O2 — CID 134178529
methyl 1-[(3-chloroquinolin-6-yl)methyl]-4-cyanopyrazole-3-carboxylate (PubChem CID 134178529) has the molecular formula C16H11ClN4O2 and a molecular weight of 326.74 g/mol. Its IUPAC name is methyl 1-[(3-chloroquinolin-6-yl)methyl]-4-cyanopyrazole-3-carboxylate.
| Compound Name | methyl 1-[(3-chloroquinolin-6-yl)methyl]-4-cyanopyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134178529 |
| Molecular Formula | C16H11ClN4O2 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | methyl 1-[(3-chloroquinolin-6-yl)methyl]-4-cyanopyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(Cc2ccc3ncc(Cl)cc3c2)cc1C#N |
| InChI | InChI=1S/C16H11ClN4O2/c1-23-16(22)15-12(6-18)9-21(20-15)8-10-2-3-14-11(4-10)5-13(17)7-19-14/h2-5,7,9H,8H2,1H3 |
| InChIKey | MMFACUNXIZCIEA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |