About tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate
tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 134179273) has the molecular formula C45H39N3O9
and a molecular weight of 765.82 g/mol. Its IUPAC name is tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate.
Molecular Properties
| Compound Name | tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate |
| PubChem CID | 134179273 |
| Molecular Formula | C45H39N3O9 |
| Molecular Weight | 765.82 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | COc1ccc(-c2ccc(OC(=O)C3CC(C(=O)Oc4ccc(-c5ccc(OC)cc5)nc4)CC(C(=O)Oc4ccc(-c5ccc(OC)cc5)nc4)C3)cn2)cc1 |
| InChI | InChI=1S/C45H39N3O9/c1-52-34-10-4-28(5-11-34)40-19-16-37(25-46-40)55-43(49)31-22-32(44(50)56-38-17-20-41(47-26-38)29-6-12-35(53-2)13-7-29)24-33(23-31)45(51)57-39-18-21-42(48-27-39)30-8-14-36(54-3)15-9-30/h4-21,25-27,31-33H,22-24H2,1-3H3 |
| InChIKey | LXAKQPYRRBDQNH-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 145.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 765.82 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate?
The IUPAC name of tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate (CID 134179273) is tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate.
What is the SMILES notation for tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate?
The canonical SMILES for tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate is COc1ccc(-c2ccc(OC(=O)C3CC(C(=O)Oc4ccc(-c5ccc(OC)cc5)nc4)CC(C(=O)Oc4ccc(-c5ccc(OC)cc5)nc4)C3)cn2)cc1.
What is the InChIKey of tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate?
The InChIKey is LXAKQPYRRBDQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H39N3O9/c1-52-34-10-4-28(5-11-34)40-19-16-37(25-46-40)55-43(49)31-22-32(44(50)56-38-17-20-41(47-26-38)29-6-12-35(53-2)13-7-29)24-33(23-31)45(51)57-39-18-21-42(48-27-39)30-8-14-36(54-3)15-9-30/h4-21,25-27,31-33H,22-24H2,1-3H3.
What are the key properties of tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate?
tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate has a molecular weight of 765.82 g/mol, XLogP of 8.05, 12 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for tris[6-(4-methoxyphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate is sourced from PubChem (CID 134179273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).