About 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine
5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine (PubChem CID 134179296) has the molecular formula C26H28N2O2
and a molecular weight of 400.52 g/mol. Its IUPAC name is 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine |
| PubChem CID | 134179296 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1c(-c2ccc(OC(C)C)cc2)ccc2ncc(-c3ccc(OC(C)C)cc3)n12 |
| InChI | InChI=1S/C26H28N2O2/c1-17(2)29-22-10-6-20(7-11-22)24-14-15-26-27-16-25(28(26)19(24)5)21-8-12-23(13-9-21)30-18(3)4/h6-18H,1-5H3 |
| InChIKey | LWYVDJMXIIPESS-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine?
The IUPAC name of 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine (CID 134179296) is 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine is Cc1c(-c2ccc(OC(C)C)cc2)ccc2ncc(-c3ccc(OC(C)C)cc3)n12.
What is the InChIKey of 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine?
The InChIKey is LWYVDJMXIIPESS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O2/c1-17(2)29-22-10-6-20(7-11-22)24-14-15-26-27-16-25(28(26)19(24)5)21-8-12-23(13-9-21)30-18(3)4/h6-18H,1-5H3.
What are the key properties of 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine?
5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine has a molecular weight of 400.52 g/mol, XLogP of 6.55, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 134179296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).