C45H42N6O3 — CID 134179299
N-[3,5-bis[methyl-(4-pyridin-2-ylbenzoyl)amino]cyclohexyl]-N-methyl-4-pyridin-2-ylbenzamide (PubChem CID 134179299) has the molecular formula C45H42N6O3 and a molecular weight of 714.87 g/mol. Its IUPAC name is N-[3,5-bis[methyl-(4-pyridin-2-ylbenzoyl)amino]cyclohexyl]-N-methyl-4-pyridin-2-ylbenzamide.
| Compound Name | N-[3,5-bis[methyl-(4-pyridin-2-ylbenzoyl)amino]cyclohexyl]-N-methyl-4-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 134179299 |
| Molecular Formula | C45H42N6O3 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.33 |
| IUPAC Name | N-[3,5-bis[methyl-(4-pyridin-2-ylbenzoyl)amino]cyclohexyl]-N-methyl-4-pyridin-2-ylbenzamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccn2)cc1)C1CC(N(C)C(=O)c2ccc(-c3ccccn3)cc2)CC(N(C)C(=O)c2ccc(-c3ccccn3)cc2)C1 |
| InChI | InChI=1S/C45H42N6O3/c1-49(43(52)34-19-13-31(14-20-34)40-10-4-7-25-46-40)37-28-38(50(2)44(53)35-21-15-32(16-22-35)41-11-5-8-26-47-41)30-39(29-37)51(3)45(54)36-23-17-33(18-24-36)42-12-6-9-27-48-42/h4-27,37-39H,28-30H2,1-3H3 |
| InChIKey | LNRHFARLQSZRQU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 99.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |