About 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine
3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine (PubChem CID 134179384) has the molecular formula C24H25N3O2
and a molecular weight of 387.48 g/mol. Its IUPAC name is 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine |
| PubChem CID | 134179384 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine |
| SMILES | CC(C)Oc1ccc(-c2ccc3ncc(-c4ccc(OC(C)C)cc4)n3n2)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-16(2)28-20-9-5-18(6-10-20)22-13-14-24-25-15-23(27(24)26-22)19-7-11-21(12-8-19)29-17(3)4/h5-17H,1-4H3 |
| InChIKey | KMKRHBSPYFQDKY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine?
The IUPAC name of 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine (CID 134179384) is 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine.
What is the SMILES notation for 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine?
The canonical SMILES for 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine is CC(C)Oc1ccc(-c2ccc3ncc(-c4ccc(OC(C)C)cc4)n3n2)cc1.
What is the InChIKey of 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine?
The InChIKey is KMKRHBSPYFQDKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O2/c1-16(2)28-20-9-5-18(6-10-20)22-13-14-24-25-15-23(27(24)26-22)19-7-11-21(12-8-19)29-17(3)4/h5-17H,1-4H3.
What are the key properties of 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine?
3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine has a molecular weight of 387.48 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(4-propan-2-yloxyphenyl)imidazo[1,2-b]pyridazine is sourced from PubChem (CID 134179384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).