About 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol
1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol (PubChem CID 134180669) has the molecular formula C12H15FN2OS
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol |
| PubChem CID | 134180669 |
| Molecular Formula | C12H15FN2OS |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cc(F)cc2sc(N)nc12 |
| InChI | InChI=1S/C12H15FN2OS/c1-12(2,3)10(16)7-4-6(13)5-8-9(7)15-11(14)17-8/h4-5,10,16H,1-3H3,(H2,14,15) |
| InChIKey | VKDNBMMLRGMHGI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol?
The IUPAC name of 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol (CID 134180669) is 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol?
The canonical SMILES for 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol is CC(C)(C)C(O)c1cc(F)cc2sc(N)nc12.
What is the InChIKey of 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol?
The InChIKey is VKDNBMMLRGMHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN2OS/c1-12(2,3)10(16)7-4-6(13)5-8-9(7)15-11(14)17-8/h4-5,10,16H,1-3H3,(H2,14,15).
What are the key properties of 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol?
1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol has a molecular weight of 254.33 g/mol, XLogP of 3.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-6-fluoro-1,3-benzothiazol-4-yl)-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 134180669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).