C20H16ClN3O4S — CID 134180802
2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl carbonochloridate (PubChem CID 134180802) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is 2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl carbonochloridate.
| Compound Name | 2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl carbonochloridate |
|---|---|
| PubChem CID | 134180802 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl carbonochloridate |
| SMILES | COc1cnc2c(-c3nc4ccc(OCCOC(=O)Cl)cc4s3)cc(C)cc2n1 |
| InChI | InChI=1S/C20H16ClN3O4S/c1-11-7-13(18-15(8-11)23-17(26-2)10-22-18)19-24-14-4-3-12(9-16(14)29-19)27-5-6-28-20(21)25/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | CEVQDPFXSWVAEN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|