C20H21N5O4S2 — CID 134181286
4,5-dimethoxy-N,N-dimethyl-2-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methyl]benzenesulfonamide (PubChem CID 134181286) has the molecular formula C20H21N5O4S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4,5-dimethoxy-N,N-dimethyl-2-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 4,5-dimethoxy-N,N-dimethyl-2-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134181286 |
| Molecular Formula | C20H21N5O4S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 4,5-dimethoxy-N,N-dimethyl-2-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methyl]benzenesulfonamide |
| SMILES | COc1cc(Cc2nnc3sc(-c4ccccc4)nn23)c(S(=O)(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C20H21N5O4S2/c1-24(2)31(26,27)17-12-16(29-4)15(28-3)10-14(17)11-18-21-22-20-25(18)23-19(30-20)13-8-6-5-7-9-13/h5-10,12H,11H2,1-4H3 |
| InChIKey | KEIFOUWARDFXPF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |