C22H16FN3O4S — CID 134181566
2-[[2-(6-cyano-3-methoxyquinolin-8-yl)-5-fluoro-1,3-benzothiazol-6-yl]oxy]propyl formate (PubChem CID 134181566) has the molecular formula C22H16FN3O4S and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-[[2-(6-cyano-3-methoxyquinolin-8-yl)-5-fluoro-1,3-benzothiazol-6-yl]oxy]propyl formate.
| Compound Name | 2-[[2-(6-cyano-3-methoxyquinolin-8-yl)-5-fluoro-1,3-benzothiazol-6-yl]oxy]propyl formate |
|---|---|
| PubChem CID | 134181566 |
| Molecular Formula | C22H16FN3O4S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[[2-(6-cyano-3-methoxyquinolin-8-yl)-5-fluoro-1,3-benzothiazol-6-yl]oxy]propyl formate |
| SMILES | COc1cnc2c(-c3nc4cc(F)c(OC(C)COC=O)cc4s3)cc(C#N)cc2c1 |
| InChI | InChI=1S/C22H16FN3O4S/c1-12(10-29-11-27)30-19-7-20-18(6-17(19)23)26-22(31-20)16-4-13(8-24)3-14-5-15(28-2)9-25-21(14)16/h3-7,9,11-12H,10H2,1-2H3 |
| InChIKey | MPJJCAZOTQUJNA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|