About (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal
(3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal (PubChem CID 134182098) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal.
Molecular Properties
| Compound Name | (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal |
| PubChem CID | 134182098 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal |
| SMILES | C=CN(C)/C=C/C=C\C(C=O)N(C)C |
| InChI | InChI=1S/C11H18N2O/c1-5-13(4)9-7-6-8-11(10-14)12(2)3/h5-11H,1H2,2-4H3/b8-6-,9-7+ |
| InChIKey | QXVGACQHZGJVKU-MKKAVFGOSA-N |
| XLogP | 1.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal?
The IUPAC name of (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal (CID 134182098) is (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal.
What is the SMILES notation for (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal?
The canonical SMILES for (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal is C=CN(C)/C=C/C=C\C(C=O)N(C)C.
What is the InChIKey of (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal?
The InChIKey is QXVGACQHZGJVKU-MKKAVFGOSA-N. The full InChI is InChI=1S/C11H18N2O/c1-5-13(4)9-7-6-8-11(10-14)12(2)3/h5-11H,1H2,2-4H3/b8-6-,9-7+.
What are the key properties of (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal?
(3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal has a molecular weight of 194.28 g/mol, XLogP of 1.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-2-(dimethylamino)-6-[ethenyl(methyl)amino]hexa-3,5-dienal is sourced from PubChem (CID 134182098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).