About 2-(4-pentylpiperidin-1-yl)propane-1,3-diol
2-(4-pentylpiperidin-1-yl)propane-1,3-diol (PubChem CID 13418215) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-(4-pentylpiperidin-1-yl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(4-pentylpiperidin-1-yl)propane-1,3-diol |
| PubChem CID | 13418215 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-(4-pentylpiperidin-1-yl)propane-1,3-diol |
| SMILES | CCCCCC1CCN(C(CO)CO)CC1 |
| InChI | InChI=1S/C13H27NO2/c1-2-3-4-5-12-6-8-14(9-7-12)13(10-15)11-16/h12-13,15-16H,2-11H2,1H3 |
| InChIKey | AEADCLOIXQMSTJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-pentylpiperidin-1-yl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-pentylpiperidin-1-yl)propane-1,3-diol?
The IUPAC name of 2-(4-pentylpiperidin-1-yl)propane-1,3-diol (CID 13418215) is 2-(4-pentylpiperidin-1-yl)propane-1,3-diol.
What is the SMILES notation for 2-(4-pentylpiperidin-1-yl)propane-1,3-diol?
The canonical SMILES for 2-(4-pentylpiperidin-1-yl)propane-1,3-diol is CCCCCC1CCN(C(CO)CO)CC1.
What is the InChIKey of 2-(4-pentylpiperidin-1-yl)propane-1,3-diol?
The InChIKey is AEADCLOIXQMSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-2-3-4-5-12-6-8-14(9-7-12)13(10-15)11-16/h12-13,15-16H,2-11H2,1H3.
What are the key properties of 2-(4-pentylpiperidin-1-yl)propane-1,3-diol?
2-(4-pentylpiperidin-1-yl)propane-1,3-diol has a molecular weight of 229.36 g/mol, XLogP of 1.63, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-pentylpiperidin-1-yl)propane-1,3-diol is sourced from PubChem (CID 13418215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).