C21H29N5O4S — CID 134182616
tert-butyl (6S)-3-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 134182616) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is tert-butyl (6S)-3-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl (6S)-3-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 134182616 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | tert-butyl (6S)-3-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | C[C@H]1Cn2ncc(N3CCN(Cc4ccccc4)S3(=O)=O)c2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29N5O4S/c1-16-13-25-19(15-24(16)20(27)30-21(2,3)4)18(12-22-25)26-11-10-23(31(26,28)29)14-17-8-6-5-7-9-17/h5-9,12,16H,10-11,13-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | AWBRJEWXDSTEMH-INIZCTEOSA-N |
| XLogP | 2.59 |
| TPSA | 87.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |