C22H28O4 — CID 134182873
(1S,2S,4R,5S,8S,9R,11R,13R)-8-hydroxy-1-methyl-7-propan-2-yl-6,16-dioxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 134182873) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (1S,2S,4R,5S,8S,9R,11R,13R)-8-hydroxy-1-methyl-7-propan-2-yl-6,16-dioxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4R,5S,8S,9R,11R,13R)-8-hydroxy-1-methyl-7-propan-2-yl-6,16-dioxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 134182873 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1S,2S,4R,5S,8S,9R,11R,13R)-8-hydroxy-1-methyl-7-propan-2-yl-6,16-dioxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CC(C)C12O[C@H]1[C@@H]1C[C@]13[C@]1(C[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4)[C@@H]2O |
| InChI | InChI=1S/C22H28O4/c1-10(2)22-16(26-22)15-8-21(15)19(3)5-4-12-13(9-25-17(12)23)14(19)6-11-7-20(11,21)18(22)24/h10-11,14-16,18,24H,4-9H2,1-3H3/t11-,14+,15+,16+,18+,19+,20+,21+,22?/m1/s1 |
| InChIKey | WXYDDWNVVIIRCD-ZARCGZRWSA-N |
| XLogP | 2.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|