C19H20Cl2F3N5S — CID 134182941
(4R)-8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine (PubChem CID 134182941) has the molecular formula C19H20Cl2F3N5S and a molecular weight of 478.37 g/mol. Its IUPAC name is (4R)-8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4R)-8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 134182941 |
| Molecular Formula | C19H20Cl2F3N5S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | (4R)-8-[5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine |
| SMILES | N[C@@H]1CCCC12CCN(c1cnc(Sc3ccnc(Cl)c3Cl)c(C(F)(F)F)n1)CC2 |
| InChI | InChI=1S/C19H20Cl2F3N5S/c20-14-11(3-7-26-16(14)21)30-17-15(19(22,23)24)28-13(10-27-17)29-8-5-18(6-9-29)4-1-2-12(18)25/h3,7,10,12H,1-2,4-6,8-9,25H2/t12-/m1/s1 |
| InChIKey | BMXRTORJYWPUKS-GFCCVEGCSA-N |
| XLogP | 5.45 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|