C15H20FN5O4S — CID 134183136
N-[1-(fluoromethyl)cyclopropyl]-3-(2-hydrazinylethyl)-1-methyl-2,4-dioxoquinazoline-6-sulfonamide (PubChem CID 134183136) has the molecular formula C15H20FN5O4S and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[1-(fluoromethyl)cyclopropyl]-3-(2-hydrazinylethyl)-1-methyl-2,4-dioxoquinazoline-6-sulfonamide.
| Compound Name | N-[1-(fluoromethyl)cyclopropyl]-3-(2-hydrazinylethyl)-1-methyl-2,4-dioxoquinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 134183136 |
| Molecular Formula | C15H20FN5O4S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[1-(fluoromethyl)cyclopropyl]-3-(2-hydrazinylethyl)-1-methyl-2,4-dioxoquinazoline-6-sulfonamide |
| SMILES | Cn1c(=O)n(CCNN)c(=O)c2cc(S(=O)(=O)NC3(CF)CC3)ccc21 |
| InChI | InChI=1S/C15H20FN5O4S/c1-20-12-3-2-10(26(24,25)19-15(9-16)4-5-15)8-11(12)13(22)21(14(20)23)7-6-18-17/h2-3,8,18-19H,4-7,9,17H2,1H3 |
| InChIKey | ARLPMSMFKUHHJQ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|