C54H42F6N4 — CID 134183428
2,4,6-tris(9,9-dimethylacridin-10-yl)-3,5-bis(trifluoromethyl)benzonitrile (PubChem CID 134183428) has the molecular formula C54H42F6N4 and a molecular weight of 860.95 g/mol. Its IUPAC name is 2,4,6-tris(9,9-dimethylacridin-10-yl)-3,5-bis(trifluoromethyl)benzonitrile.
| Compound Name | 2,4,6-tris(9,9-dimethylacridin-10-yl)-3,5-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134183428 |
| Molecular Formula | C54H42F6N4 |
| Molecular Weight | 860.95 g/mol |
| Exact Mass | 860.33 |
| IUPAC Name | 2,4,6-tris(9,9-dimethylacridin-10-yl)-3,5-bis(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)c2ccccc2N(c2c(C#N)c(N3c4ccccc4C(C)(C)c4ccccc43)c(C(F)(F)F)c(N3c4ccccc4C(C)(C)c4ccccc43)c2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C54H42F6N4/c1-50(2)33-19-7-13-25-39(33)62(40-26-14-8-20-34(40)50)47-32(31-61)48(63-41-27-15-9-21-35(41)51(3,4)36-22-10-16-28-42(36)63)46(54(58,59)60)49(45(47)53(55,56)57)64-43-29-17-11-23-37(43)52(5,6)38-24-12-18-30-44(38)64/h7-30H,1-6H3 |
| InChIKey | IDZGIZFZHMDLEJ-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.95 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |