About 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one
6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (PubChem CID 134183525) has the molecular formula C18H13Cl2N3O2S
and a molecular weight of 406.29 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 134183525 |
| Molecular Formula | C18H13Cl2N3O2S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| SMILES | COCC#Cc1cn(-c2c(Cl)cccc2Cl)c(=O)c2cnc(SC)nc12 |
| InChI | InChI=1S/C18H13Cl2N3O2S/c1-25-8-4-5-11-10-23(16-13(19)6-3-7-14(16)20)17(24)12-9-21-18(26-2)22-15(11)12/h3,6-7,9-10H,8H2,1-2H3 |
| InChIKey | NRCSMEDMWBTYHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (CID 134183525) is 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is COCC#Cc1cn(-c2c(Cl)cccc2Cl)c(=O)c2cnc(SC)nc12.
What is the InChIKey of 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The InChIKey is NRCSMEDMWBTYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2N3O2S/c1-25-8-4-5-11-10-23(16-13(19)6-3-7-14(16)20)17(24)12-9-21-18(26-2)22-15(11)12/h3,6-7,9-10H,8H2,1-2H3.
What are the key properties of 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one has a molecular weight of 406.29 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichlorophenyl)-8-(3-methoxyprop-1-ynyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 134183525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).