C12H12N4O2 — CID 134184113
1,4-bis(ethenyl)-3,6-bis(ethenylimino)piperazine-2,5-dione (PubChem CID 134184113) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1,4-bis(ethenyl)-3,6-bis(ethenylimino)piperazine-2,5-dione.
| Compound Name | 1,4-bis(ethenyl)-3,6-bis(ethenylimino)piperazine-2,5-dione |
|---|---|
| PubChem CID | 134184113 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1,4-bis(ethenyl)-3,6-bis(ethenylimino)piperazine-2,5-dione |
| SMILES | C=C/N=C1\C(=O)N(C=C)/C(=N/C=C)C(=O)N1C=C |
| InChI | InChI=1S/C12H12N4O2/c1-5-13-9-11(17)16(8-4)10(14-6-2)12(18)15(9)7-3/h5-8H,1-4H2/b13-9+,14-10+ |
| InChIKey | DBKSZMSXMFTSKH-UTLPMFLDSA-N |
| XLogP | 1.03 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|