About 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine
1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine (PubChem CID 134184117) has the molecular formula C25H46N2O
and a molecular weight of 390.66 g/mol. Its IUPAC name is 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine.
Molecular Properties
| Compound Name | 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine |
| PubChem CID | 134184117 |
| Molecular Formula | C25H46N2O |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.36 |
| IUPAC Name | 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine |
| SMILES | CC(C)(CCC(C)(C)C1CCN(C2COC2)CC1)C1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C25H46N2O/c1-24(2,20-8-14-26(15-9-20)22-6-5-7-22)12-13-25(3,4)21-10-16-27(17-11-21)23-18-28-19-23/h20-23H,5-19H2,1-4H3 |
| InChIKey | BIOPZRSGKGRUNS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine?
The IUPAC name of 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine (CID 134184117) is 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine.
What is the SMILES notation for 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine?
The canonical SMILES for 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine is CC(C)(CCC(C)(C)C1CCN(C2COC2)CC1)C1CCN(C2CCC2)CC1.
What is the InChIKey of 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine?
The InChIKey is BIOPZRSGKGRUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46N2O/c1-24(2,20-8-14-26(15-9-20)22-6-5-7-22)12-13-25(3,4)21-10-16-27(17-11-21)23-18-28-19-23/h20-23H,5-19H2,1-4H3.
What are the key properties of 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine?
1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine has a molecular weight of 390.66 g/mol, XLogP of 5.19, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-4-[2,5-dimethyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]piperidine is sourced from PubChem (CID 134184117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).