C26H22F3NO7 — CID 134184445
(4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[4-(trifluoromethyl)phenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184445) has the molecular formula C26H22F3NO7 and a molecular weight of 517.46 g/mol. Its IUPAC name is (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[4-(trifluoromethyl)phenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[4-(trifluoromethyl)phenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184445 |
| Molecular Formula | C26H22F3NO7 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[4-(trifluoromethyl)phenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(C(F)(F)F)cc5)c4C[C@H]3C[C@H]2CC1O |
| InChI | InChI=1S/C26H22F3NO7/c27-26(28,29)12-3-1-10(2-4-12)14-5-6-16(31)19-15(14)8-11-7-13-9-17(32)20(24(30)36)23(35)25(13,37)22(34)18(11)21(19)33/h1-6,11,13,17,20,31-33,37H,7-9H2,(H2,30,36)/t11-,13+,17?,20?,25+/m1/s1 |
| InChIKey | PZTYJYVOJDLNCV-JJXCUTFKSA-N |
| XLogP | 2.27 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|