About 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one
1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 134184448) has the molecular formula C14H14N6OS
and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
Molecular Properties
| Compound Name | 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| PubChem CID | 134184448 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(SC)nc2n1-c1cccc(N)n1 |
| InChI | InChI=1S/C14H14N6OS/c1-3-7-19-13(21)9-8-16-14(22-2)18-12(9)20(19)11-6-4-5-10(15)17-11/h3-6,8H,1,7H2,2H3,(H2,15,17) |
| InChIKey | JGAAUWJSADRTDG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one?
The IUPAC name of 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (CID 134184448) is 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
What is the SMILES notation for 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one?
The canonical SMILES for 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one is C=CCn1c(=O)c2cnc(SC)nc2n1-c1cccc(N)n1.
What is the InChIKey of 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one?
The InChIKey is JGAAUWJSADRTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6OS/c1-3-7-19-13(21)9-8-16-14(22-2)18-12(9)20(19)11-6-4-5-10(15)17-11/h3-6,8H,1,7H2,2H3,(H2,15,17).
What are the key properties of 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one?
1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one has a molecular weight of 314.37 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2-pyridinyl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one is sourced from PubChem (CID 134184448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).