C14H15F3O3 — CID 13418454
2-ethoxy-4-phenoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran (PubChem CID 13418454) has the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-ethoxy-4-phenoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran.
| Compound Name | 2-ethoxy-4-phenoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 13418454 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-ethoxy-4-phenoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran |
| SMILES | CCOC1CC(Oc2ccccc2)C=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C14H15F3O3/c1-2-18-13-9-11(8-12(20-13)14(15,16)17)19-10-6-4-3-5-7-10/h3-8,11,13H,2,9H2,1H3 |
| InChIKey | ICPWASTXHONAKD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |