C26H22FNO8 — CID 134184632
(4aR,5S,5aR,6Z,12aR)-6-[(4-fluorophenyl)methylidene]-3,5,10,11,12a-pentahydroxy-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide (PubChem CID 134184632) has the molecular formula C26H22FNO8 and a molecular weight of 495.46 g/mol. Its IUPAC name is (4aR,5S,5aR,6Z,12aR)-6-[(4-fluorophenyl)methylidene]-3,5,10,11,12a-pentahydroxy-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6Z,12aR)-6-[(4-fluorophenyl)methylidene]-3,5,10,11,12a-pentahydroxy-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184632 |
| Molecular Formula | C26H22FNO8 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (4aR,5S,5aR,6Z,12aR)-6-[(4-fluorophenyl)methylidene]-3,5,10,11,12a-pentahydroxy-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(F)cc4)[C@H]3[C@H](O)[C@H]2CC1O |
| InChI | InChI=1S/C26H22FNO8/c27-11-6-4-10(5-7-11)8-13-12-2-1-3-15(29)17(12)22(32)20-18(13)21(31)14-9-16(30)19(25(28)35)23(33)26(14,36)24(20)34/h1-8,14,16,18-19,21,29-32,36H,9H2,(H2,28,35)/b13-8+/t14-,16?,18-,19?,21-,26-/m1/s1 |
| InChIKey | BGFLMHLRVPYWOU-ZRMQOFPFSA-N |
| XLogP | 0.70 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|