C27H22FNO7 — CID 134184742
(4aS,5aR,12aR)-7-[2-(2-fluorophenyl)ethynyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184742) has the molecular formula C27H22FNO7 and a molecular weight of 491.47 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[2-(2-fluorophenyl)ethynyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-[2-(2-fluorophenyl)ethynyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184742 |
| Molecular Formula | C27H22FNO7 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (4aS,5aR,12aR)-7-[2-(2-fluorophenyl)ethynyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C#Cc5ccccc5F)c4C[C@H]3C[C@H]2CC1O |
| InChI | InChI=1S/C27H22FNO7/c28-17-4-2-1-3-13(17)6-5-12-7-8-18(30)21-16(12)10-14-9-15-11-19(31)22(26(29)35)25(34)27(15,36)24(33)20(14)23(21)32/h1-4,7-8,14-15,19,22,30-32,36H,9-11H2,(H2,29,35)/t14-,15+,19?,22?,27+/m1/s1 |
| InChIKey | BLARZIZFYLDPTH-YLSBJDLOSA-N |
| XLogP | 1.13 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|