C26H24FNO7 — CID 134184769
(4aS,5aR,12aR)-7-(4-fluoro-3-methylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184769) has the molecular formula C26H24FNO7 and a molecular weight of 481.48 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(4-fluoro-3-methylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(4-fluoro-3-methylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184769 |
| Molecular Formula | C26H24FNO7 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (4aS,5aR,12aR)-7-(4-fluoro-3-methylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | Cc1cc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2=C3O)ccc1F |
| InChI | InChI=1S/C26H24FNO7/c1-10-6-11(2-4-16(10)27)14-3-5-17(29)20-15(14)8-12-7-13-9-18(30)21(25(28)34)24(33)26(13,35)23(32)19(12)22(20)31/h2-6,12-13,18,21,29-31,35H,7-9H2,1H3,(H2,28,34)/t12-,13+,18?,21?,26+/m1/s1 |
| InChIKey | QLAXSLHODSCNEK-ANUPTXOASA-N |
| XLogP | 1.70 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|