C28H24F3NO7 — CID 134184778
(4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184778) has the molecular formula C28H24F3NO7 and a molecular weight of 543.49 g/mol. Its IUPAC name is (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184778 |
| Molecular Formula | C28H24F3NO7 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-1,12-dioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(/C=C/c5ccc(C(F)(F)F)cc5)c4C[C@H]3C[C@H]2CC1O |
| InChI | InChI=1S/C28H24F3NO7/c29-28(30,31)15-6-2-12(3-7-15)1-4-13-5-8-18(33)21-17(13)10-14-9-16-11-19(34)22(26(32)38)25(37)27(16,39)24(36)20(14)23(21)35/h1-8,14,16,19,22,33-35,39H,9-11H2,(H2,32,38)/b4-1+/t14-,16+,19?,22?,27+/m1/s1 |
| InChIKey | CFKCTZBEXBFNEO-GJUCMSLRSA-N |
| XLogP | 2.78 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|