C11H9F3S — CID 134184955
5-[(Z)-3,3,3-trifluoroprop-1-enyl]-5,6-dihydro-1-benzothiophene (PubChem CID 134184955) has the molecular formula C11H9F3S and a molecular weight of 230.25 g/mol. Its IUPAC name is 5-[(Z)-3,3,3-trifluoroprop-1-enyl]-5,6-dihydro-1-benzothiophene.
| Compound Name | 5-[(Z)-3,3,3-trifluoroprop-1-enyl]-5,6-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 134184955 |
| Molecular Formula | C11H9F3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5-[(Z)-3,3,3-trifluoroprop-1-enyl]-5,6-dihydro-1-benzothiophene |
| SMILES | FC(F)(F)/C=C\C1C=c2ccsc2=CC1 |
| InChI | InChI=1S/C11H9F3S/c12-11(13,14)5-3-8-1-2-10-9(7-8)4-6-15-10/h2-8H,1H2/b5-3- |
| InChIKey | KYWPZTVSDIXNHJ-HYXAFXHYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|