C33H62N4 — CID 134185061
2,3,7,13,17-pentaethyl-8,12,18-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin (PubChem CID 134185061) has the molecular formula C33H62N4 and a molecular weight of 514.89 g/mol. Its IUPAC name is 2,3,7,13,17-pentaethyl-8,12,18-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin.
| Compound Name | 2,3,7,13,17-pentaethyl-8,12,18-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
|---|---|
| PubChem CID | 134185061 |
| Molecular Formula | C33H62N4 |
| Molecular Weight | 514.89 g/mol |
| Exact Mass | 514.50 |
| IUPAC Name | 2,3,7,13,17-pentaethyl-8,12,18-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
| SMILES | CCC1C2CC3NC(CC4NC(CC5NC(CC(N2)C1C)C(C)C5CC)C(CC)C4CC)C(C)C3CC |
| InChI | InChI=1S/C33H62N4/c1-9-21-18(6)26-14-27-19(7)22(10-2)31(35-27)17-33-25(13-5)24(12-4)32(37-33)15-28-20(8)23(11-3)30(36-28)16-29(21)34-26/h18-37H,9-17H2,1-8H3 |
| InChIKey | WWLLUQLUBHCNDL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.89 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |