C15H14BrClF2N4 — CID 134185226
5-bromo-2-chloro-4-N-(3,4-difluorophenyl)-6-N-methyl-4-N-(2-methylprop-2-enyl)pyrimidine-4,6-diamine (PubChem CID 134185226) has the molecular formula C15H14BrClF2N4 and a molecular weight of 403.66 g/mol. Its IUPAC name is 5-bromo-2-chloro-4-N-(3,4-difluorophenyl)-6-N-methyl-4-N-(2-methylprop-2-enyl)pyrimidine-4,6-diamine.
| Compound Name | 5-bromo-2-chloro-4-N-(3,4-difluorophenyl)-6-N-methyl-4-N-(2-methylprop-2-enyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 134185226 |
| Molecular Formula | C15H14BrClF2N4 |
| Molecular Weight | 403.66 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 5-bromo-2-chloro-4-N-(3,4-difluorophenyl)-6-N-methyl-4-N-(2-methylprop-2-enyl)pyrimidine-4,6-diamine |
| SMILES | C=C(C)CN(c1ccc(F)c(F)c1)c1nc(Cl)nc(NC)c1Br |
| InChI | InChI=1S/C15H14BrClF2N4/c1-8(2)7-23(9-4-5-10(18)11(19)6-9)14-12(16)13(20-3)21-15(17)22-14/h4-6H,1,7H2,2-3H3,(H,20,21,22) |
| InChIKey | USRPHGDQVWQTSE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|