C14H13F2N3S — CID 134185461
3-[(1E)-3-[3-(difluoromethyl)phenyl]buta-1,3-dienyl]sulfanyl-4-methyl-1,2,4-triazole (PubChem CID 134185461) has the molecular formula C14H13F2N3S and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-[(1E)-3-[3-(difluoromethyl)phenyl]buta-1,3-dienyl]sulfanyl-4-methyl-1,2,4-triazole.
| Compound Name | 3-[(1E)-3-[3-(difluoromethyl)phenyl]buta-1,3-dienyl]sulfanyl-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 134185461 |
| Molecular Formula | C14H13F2N3S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-[(1E)-3-[3-(difluoromethyl)phenyl]buta-1,3-dienyl]sulfanyl-4-methyl-1,2,4-triazole |
| SMILES | C=C(/C=C/Sc1nncn1C)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C14H13F2N3S/c1-10(6-7-20-14-18-17-9-19(14)2)11-4-3-5-12(8-11)13(15)16/h3-9,13H,1H2,2H3/b7-6+ |
| InChIKey | CEOGHPSFQQEWPB-VOTSOKGWSA-N |
| XLogP | 4.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|