C44H38N6S — CID 134185766
4-N,9-N-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-N,9-N,6,7-tetraphenyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-diamine (PubChem CID 134185766) has the molecular formula C44H38N6S and a molecular weight of 682.90 g/mol. Its IUPAC name is 4-N,9-N-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-N,9-N,6,7-tetraphenyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-diamine.
| Compound Name | 4-N,9-N-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-N,9-N,6,7-tetraphenyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-diamine |
|---|---|
| PubChem CID | 134185766 |
| Molecular Formula | C44H38N6S |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | 4-N,9-N-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-N,9-N,6,7-tetraphenyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline-4,9-diamine |
| SMILES | C/C=C\C(=C/C)N(c1ccccc1)c1c2nsnc2c(N(C(/C=C\C)=C/C)c2ccccc2)c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C44H38N6S/c1-5-21-33(7-3)49(35-27-17-11-18-28-35)43-39-40(46-38(32-25-15-10-16-26-32)37(45-39)31-23-13-9-14-24-31)44(42-41(43)47-51-48-42)50(34(8-4)22-6-2)36-29-19-12-20-30-36/h5-30H,1-4H3/b21-5-,22-6-,33-7+,34-8+ |
| InChIKey | URKWCKFWWHNFBC-JILOHYFQSA-N |
| XLogP | 12.20 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|